C18H19F3N8O2 — CID 71549117
3-[5-[[(2R)-3-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)butan-2-yl]amino]-1,2,4-triazin-3-yl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 71549117) has the molecular formula C18H19F3N8O2 and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-[5-[[(2R)-3-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)butan-2-yl]amino]-1,2,4-triazin-3-yl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 3-[5-[[(2R)-3-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)butan-2-yl]amino]-1,2,4-triazin-3-yl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 71549117 |
| Molecular Formula | C18H19F3N8O2 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-[5-[[(2R)-3-methyl-1-oxo-1-(2,2,2-trifluoroethylamino)butan-2-yl]amino]-1,2,4-triazin-3-yl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | CC(C)[C@@H](Nc1cnnc(-c2c[nH]c3ncc(C(N)=O)cc23)n1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H19F3N8O2/c1-8(2)13(17(31)25-7-18(19,20)21)27-12-6-26-29-16(28-12)11-5-24-15-10(11)3-9(4-23-15)14(22)30/h3-6,8,13H,7H2,1-2H3,(H2,22,30)(H,23,24)(H,25,31)(H,27,28,29)/t13-/m1/s1 |
| InChIKey | DIQUSBRSKPBFHX-CYBMUJFWSA-N |
| XLogP | 1.63 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |