About 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one
6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one (PubChem CID 71549344) has the molecular formula C23H17ClO2
and a molecular weight of 360.84 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one |
| PubChem CID | 71549344 |
| Molecular Formula | C23H17ClO2 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3ccccc3)c2c(C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClO2/c1-14-12-20-23(15(2)22(14)17-8-10-18(24)11-9-17)19(13-21(25)26-20)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | STOLJQNAWOSACU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The IUPAC name of 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one (CID 71549344) is 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one.
What is the SMILES notation for 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The canonical SMILES for 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one is Cc1cc2oc(=O)cc(-c3ccccc3)c2c(C)c1-c1ccc(Cl)cc1.
What is the InChIKey of 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
The InChIKey is STOLJQNAWOSACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17ClO2/c1-14-12-20-23(15(2)22(14)17-8-10-18(24)11-9-17)19(13-21(25)26-20)16-6-4-3-5-7-16/h3-13H,1-2H3.
What are the key properties of 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one?
6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one has a molecular weight of 360.84 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-5,7-dimethyl-4-phenylchromen-2-one is sourced from PubChem (CID 71549344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).