About 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine
6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine (PubChem CID 71549587) has the molecular formula C23H20N4O2S
and a molecular weight of 416.51 g/mol. Its IUPAC name is 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine |
| PubChem CID | 71549587 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine |
| SMILES | COc1cc2ncn(Cc3ccc4nc(Nc5ccccc5)sc4c3)c2cc1OC |
| InChI | InChI=1S/C23H20N4O2S/c1-28-20-11-18-19(12-21(20)29-2)27(14-24-18)13-15-8-9-17-22(10-15)30-23(26-17)25-16-6-4-3-5-7-16/h3-12,14H,13H2,1-2H3,(H,25,26) |
| InChIKey | FBFUOMRPTMYFCQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine?
The IUPAC name of 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine (CID 71549587) is 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine is COc1cc2ncn(Cc3ccc4nc(Nc5ccccc5)sc4c3)c2cc1OC.
What is the InChIKey of 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine?
The InChIKey is FBFUOMRPTMYFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O2S/c1-28-20-11-18-19(12-21(20)29-2)27(14-24-18)13-15-8-9-17-22(10-15)30-23(26-17)25-16-6-4-3-5-7-16/h3-12,14H,13H2,1-2H3,(H,25,26).
What are the key properties of 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine?
6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine has a molecular weight of 416.51 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5,6-dimethoxybenzimidazol-1-yl)methyl]-N-phenyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 71549587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).