C23H26N2O6 — CID 71549705
(5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-propan-2-yl-1,3-oxazolidine-5-carboxamide (PubChem CID 71549705) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-propan-2-yl-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-propan-2-yl-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71549705 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-propan-2-yl-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@]2(Cc3ccccc3)OC(=O)N(C(C)C)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C23H26N2O6/c1-15(2)25-21(27)23(31-22(25)28,13-16-8-6-5-7-9-16)20(26)24-14-17-10-18(29-3)12-19(11-17)30-4/h5-12,15H,13-14H2,1-4H3,(H,24,26)/t23-/m1/s1 |
| InChIKey | GYLWBZWFJFWZEQ-HSZRJFAPSA-N |
| XLogP | 2.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|