C30H30N2O6 — CID 71549706
(5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-oxazolidine-5-carboxamide (PubChem CID 71549706) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71549706 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (5R)-5-benzyl-N-[(3,5-dimethoxyphenyl)methyl]-2,4-dioxo-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@@]2(Cc3ccccc3)OC(=O)N(C3CCCc4ccccc43)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C30H30N2O6/c1-36-23-15-21(16-24(17-23)37-2)19-31-27(33)30(18-20-9-4-3-5-10-20)28(34)32(29(35)38-30)26-14-8-12-22-11-6-7-13-25(22)26/h3-7,9-11,13,15-17,26H,8,12,14,18-19H2,1-2H3,(H,31,33)/t26?,30-/m1/s1 |
| InChIKey | BJIJYPHJHHHWTD-NPRFROTHSA-N |
| XLogP | 4.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|