C27H24N2O4 — CID 71550119
(5R)-5-benzyl-5-(1,3-dihydroisoindole-2-carbonyl)-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-2,4-dione (PubChem CID 71550119) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (5R)-5-benzyl-5-(1,3-dihydroisoindole-2-carbonyl)-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-5-(1,3-dihydroisoindole-2-carbonyl)-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 71550119 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (5R)-5-benzyl-5-(1,3-dihydroisoindole-2-carbonyl)-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-2,4-dione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)O[C@](Cc2ccccc2)(C(=O)N2Cc3ccccc3C2)C1=O |
| InChI | InChI=1S/C27H24N2O4/c1-19(21-12-6-3-7-13-21)29-25(31)27(33-26(29)32,16-20-10-4-2-5-11-20)24(30)28-17-22-14-8-9-15-23(22)18-28/h2-15,19H,16-18H2,1H3/t19-,27-/m1/s1 |
| InChIKey | DDKWVFUFOHVKGG-XHCCPWGMSA-N |
| XLogP | 4.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|