About 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine
3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine (PubChem CID 71550203) has the molecular formula C18H17FN4
and a molecular weight of 308.36 g/mol. Its IUPAC name is 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine.
Molecular Properties
| Compound Name | 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine |
| PubChem CID | 71550203 |
| Molecular Formula | C18H17FN4 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine |
| SMILES | CC1(C)Cc2ccc(-c3cncnc3)cc2C12C=C(F)C(N)=N2 |
| InChI | InChI=1S/C18H17FN4/c1-17(2)6-12-4-3-11(13-8-21-10-22-9-13)5-14(12)18(17)7-15(19)16(20)23-18/h3-5,7-10H,6H2,1-2H3,(H2,20,23) |
| InChIKey | ORILNYIQHJPETP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine?
The IUPAC name of 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine (CID 71550203) is 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine.
What is the SMILES notation for 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine?
The canonical SMILES for 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine is CC1(C)Cc2ccc(-c3cncnc3)cc2C12C=C(F)C(N)=N2.
What is the InChIKey of 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine?
The InChIKey is ORILNYIQHJPETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4/c1-17(2)6-12-4-3-11(13-8-21-10-22-9-13)5-14(12)18(17)7-15(19)16(20)23-18/h3-5,7-10H,6H2,1-2H3,(H2,20,23).
What are the key properties of 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine?
3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine has a molecular weight of 308.36 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-fluoro-2,2-dimethyl-5-pyrimidin-5-ylspiro[1H-indene-3,5'-pyrrole]-2'-amine is sourced from PubChem (CID 71550203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).