C17H16F3N5O4 — CID 71550224
(5R)-5-(difluoromethyl)-5-[2-fluoro-5-[(3-methoxy-5-nitro-2-pyridinyl)amino]phenyl]-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 71550224) has the molecular formula C17H16F3N5O4 and a molecular weight of 411.34 g/mol. Its IUPAC name is (5R)-5-(difluoromethyl)-5-[2-fluoro-5-[(3-methoxy-5-nitro-2-pyridinyl)amino]phenyl]-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (5R)-5-(difluoromethyl)-5-[2-fluoro-5-[(3-methoxy-5-nitro-2-pyridinyl)amino]phenyl]-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 71550224 |
| Molecular Formula | C17H16F3N5O4 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (5R)-5-(difluoromethyl)-5-[2-fluoro-5-[(3-methoxy-5-nitro-2-pyridinyl)amino]phenyl]-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | COc1cc([N+](=O)[O-])cnc1Nc1ccc(F)c([C@]2(C(F)F)COCC(N)=N2)c1 |
| InChI | InChI=1S/C17H16F3N5O4/c1-28-13-5-10(25(26)27)6-22-15(13)23-9-2-3-12(18)11(4-9)17(16(19)20)8-29-7-14(21)24-17/h2-6,16H,7-8H2,1H3,(H2,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | MALBXUIZEBZONF-KRWDZBQOSA-N |
| XLogP | 2.73 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|