C28H27N3O3 — CID 71550250
(5R)-5-benzyl-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-[(1R)-1-phenylethyl]imidazolidine-2,4-dione (PubChem CID 71550250) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is (5R)-5-benzyl-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-[(1R)-1-phenylethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-[(1R)-1-phenylethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71550250 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (5R)-5-benzyl-5-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-3-[(1R)-1-phenylethyl]imidazolidine-2,4-dione |
| SMILES | C[C@H](c1ccccc1)N1C(=O)N[C@](Cc2ccccc2)(C(=O)N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C28H27N3O3/c1-20(22-12-6-3-7-13-22)31-26(33)28(29-27(31)34,18-21-10-4-2-5-11-21)25(32)30-17-16-23-14-8-9-15-24(23)19-30/h2-15,20H,16-19H2,1H3,(H,29,34)/t20-,28-/m1/s1 |
| InChIKey | KGKCCVMCOIHHNJ-PIIWDFAUSA-N |
| XLogP | 3.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|