About CID 71550347
CID 71550347 (PubChem CID 71550347) has the molecular formula C25H27FN2O2
and a molecular weight of 406.50 g/mol.
Molecular Properties
| Compound Name | CID 71550347 |
| PubChem CID | 71550347 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | — |
| SMILES | COc1cccc(-c2ccc3c(c2)C2(C=C(F)C(N)=N2)C2(CCC(OC)CC2)C3)c1 |
| InChI | InChI=1S/C25H27FN2O2/c1-29-19-8-10-24(11-9-19)14-18-7-6-17(16-4-3-5-20(12-16)30-2)13-21(18)25(24)15-22(26)23(27)28-25/h3-7,12-13,15,19H,8-11,14H2,1-2H3,(H2,27,28) |
| InChIKey | PRTNYNVJRGECCP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 71550347 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71550347?
The IUPAC name of CID 71550347 (CID 71550347) is not available.
What is the SMILES notation for CID 71550347?
The canonical SMILES for CID 71550347 is COc1cccc(-c2ccc3c(c2)C2(C=C(F)C(N)=N2)C2(CCC(OC)CC2)C3)c1.
What is the InChIKey of CID 71550347?
The InChIKey is PRTNYNVJRGECCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27FN2O2/c1-29-19-8-10-24(11-9-19)14-18-7-6-17(16-4-3-5-20(12-16)30-2)13-21(18)25(24)15-22(26)23(27)28-25/h3-7,12-13,15,19H,8-11,14H2,1-2H3,(H2,27,28).
What are the key properties of CID 71550347?
CID 71550347 has a molecular weight of 406.50 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71550347 is sourced from PubChem (CID 71550347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).