C21H19FN6OS2 — CID 71550646
(5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71550646) has the molecular formula C21H19FN6OS2 and a molecular weight of 454.56 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71550646 |
| Molecular Formula | C21H19FN6OS2 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | (5Z)-5-[[3-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCN(c2ccc(-n3cnc4ccc(/C=C5\SC(=S)NC5=O)nc43)cc2F)CC1 |
| InChI | InChI=1S/C21H19FN6OS2/c1-26-6-8-27(9-7-26)17-5-3-14(11-15(17)22)28-12-23-16-4-2-13(24-19(16)28)10-18-20(29)25-21(30)31-18/h2-5,10-12H,6-9H2,1H3,(H,25,29,30)/b18-10- |
| InChIKey | ZITWHASDCBTBJX-ZDLGFXPLSA-N |
| XLogP | 2.80 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|