C22H20N6O3S — CID 71550649
(5Z)-5-[[3-[3-(4-methylpiperazine-1-carbonyl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 71550649) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-(4-methylpiperazine-1-carbonyl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[3-(4-methylpiperazine-1-carbonyl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 71550649 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (5Z)-5-[[3-[3-(4-methylpiperazine-1-carbonyl)phenyl]imidazo[4,5-b]pyridin-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(C(=O)c2cccc(-n3cnc4ccc(/C=C5\SC(=O)NC5=O)nc43)c2)CC1 |
| InChI | InChI=1S/C22H20N6O3S/c1-26-7-9-27(10-8-26)21(30)14-3-2-4-16(11-14)28-13-23-17-6-5-15(24-19(17)28)12-18-20(29)25-22(31)32-18/h2-6,11-13H,7-10H2,1H3,(H,25,29,31)/b18-12- |
| InChIKey | VOSIVKOWHYRGSM-PDGQHHTCSA-N |
| XLogP | 2.13 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|