C17H26N2O2 — CID 71550883
methyl 2-[(2S,4S)-6-[(8aS)-1,2,3,5,6,8a-hexahydroindolizin-8-yl]-4-methyl-2,3,4,5-tetrahydropyridin-2-yl]acetate (PubChem CID 71550883) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is methyl 2-[(2S,4S)-6-[(8aS)-1,2,3,5,6,8a-hexahydroindolizin-8-yl]-4-methyl-2,3,4,5-tetrahydropyridin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4S)-6-[(8aS)-1,2,3,5,6,8a-hexahydroindolizin-8-yl]-4-methyl-2,3,4,5-tetrahydropyridin-2-yl]acetate |
|---|---|
| PubChem CID | 71550883 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | methyl 2-[(2S,4S)-6-[(8aS)-1,2,3,5,6,8a-hexahydroindolizin-8-yl]-4-methyl-2,3,4,5-tetrahydropyridin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](C)CC(C2=CCCN3CCC[C@@H]23)=N1 |
| InChI | InChI=1S/C17H26N2O2/c1-12-9-13(11-17(20)21-2)18-15(10-12)14-5-3-7-19-8-4-6-16(14)19/h5,12-13,16H,3-4,6-11H2,1-2H3/t12-,13-,16-/m0/s1 |
| InChIKey | FOKUWLHFPJKDKM-XEZPLFJOSA-N |
| XLogP | 2.58 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |