About [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride (PubChem CID 71550960) has the molecular formula C9H18ClNO3S
and a molecular weight of 255.77 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride.
Molecular Properties
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride |
| PubChem CID | 71550960 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)OC[C@H]1CN2CCC1CC2.Cl |
| InChI | InChI=1S/C9H17NO3S.ClH/c1-14(11,12)13-7-9-6-10-4-2-8(9)3-5-10;/h8-9H,2-7H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | RNFJXIBMWZZPIX-SBSPUUFOSA-N |
| XLogP | 0.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride?
The IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride (CID 71550960) is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride.
What is the SMILES notation for [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride?
The canonical SMILES for [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride is CS(=O)(=O)OC[C@H]1CN2CCC1CC2.Cl.
What is the InChIKey of [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride?
The InChIKey is RNFJXIBMWZZPIX-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H17NO3S.ClH/c1-14(11,12)13-7-9-6-10-4-2-8(9)3-5-10;/h8-9H,2-7H2,1H3;1H/t9-;/m1./s1.
What are the key properties of [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride?
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride has a molecular weight of 255.77 g/mol, XLogP of 0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-azabicyclo[2.2.2]octan-3-yl]methyl methanesulfonate;hydrochloride is sourced from PubChem (CID 71550960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).