C28H28N2O4 — CID 71551575
diethyl 1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 71551575) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is diethyl 1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | diethyl 1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 71551575 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | diethyl 1,2,3-triphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(c2ccccc2)C(c2ccccc2)N(c2ccccc2)C1 |
| InChI | InChI=1S/C28H28N2O4/c1-3-33-27(31)24-20-29(22-16-10-6-11-17-22)26(21-14-8-5-9-15-21)30(23-18-12-7-13-19-23)25(24)28(32)34-4-2/h5-19,26H,3-4,20H2,1-2H3 |
| InChIKey | OQWGEOWYXJRVDG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |