About 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine
4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine (PubChem CID 715516) has the molecular formula C19H16N6O
and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine |
| PubChem CID | 715516 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N(c2ccccc2)c2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C19H16N6O/c1-26-19-22-17(24-13-12-20-14-24)21-18(23-19)25(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,1H3 |
| InChIKey | ONQRAYLUTWMTGL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine?
The IUPAC name of 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine (CID 715516) is 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine is COc1nc(N(c2ccccc2)c2ccccc2)nc(-n2ccnc2)n1.
What is the InChIKey of 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine?
The InChIKey is ONQRAYLUTWMTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N6O/c1-26-19-22-17(24-13-12-20-14-24)21-18(23-19)25(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,1H3.
What are the key properties of 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine?
4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine has a molecular weight of 344.38 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-yl-6-methoxy-N,N-diphenyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 715516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).