About 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline
4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline (PubChem CID 71551696) has the molecular formula C13H11ClN2S
and a molecular weight of 262.76 g/mol. Its IUPAC name is 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline |
| PubChem CID | 71551696 |
| Molecular Formula | C13H11ClN2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline |
| SMILES | CCCc1nc2c(Cl)nc3ccccc3c2s1 |
| InChI | InChI=1S/C13H11ClN2S/c1-2-5-10-16-11-12(17-10)8-6-3-4-7-9(8)15-13(11)14/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | ZVLOMFDDXOIDRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline?
The IUPAC name of 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline (CID 71551696) is 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline.
What is the SMILES notation for 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline?
The canonical SMILES for 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline is CCCc1nc2c(Cl)nc3ccccc3c2s1.
What is the InChIKey of 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline?
The InChIKey is ZVLOMFDDXOIDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2S/c1-2-5-10-16-11-12(17-10)8-6-3-4-7-9(8)15-13(11)14/h3-4,6-7H,2,5H2,1H3.
What are the key properties of 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline?
4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline has a molecular weight of 262.76 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-propyl-[1,3]thiazolo[4,5-c]quinoline is sourced from PubChem (CID 71551696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).