About 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine
2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine (PubChem CID 71551812) has the molecular formula C14H15N3S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| PubChem CID | 71551812 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| SMILES | CC[C@H](C)c1nc2c(N)nc3ccccc3c2s1 |
| InChI | InChI=1S/C14H15N3S/c1-3-8(2)14-17-11-12(18-14)9-6-4-5-7-10(9)16-13(11)15/h4-8H,3H2,1-2H3,(H2,15,16)/t8-/m0/s1 |
| InChIKey | PZGJETZMHQPUSH-QMMMGPOBSA-N |
| XLogP | 3.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The IUPAC name of 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine (CID 71551812) is 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The canonical SMILES for 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine is CC[C@H](C)c1nc2c(N)nc3ccccc3c2s1.
What is the InChIKey of 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine?
The InChIKey is PZGJETZMHQPUSH-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H15N3S/c1-3-8(2)14-17-11-12(18-14)9-6-4-5-7-10(9)16-13(11)15/h4-8H,3H2,1-2H3,(H2,15,16)/t8-/m0/s1.
What are the key properties of 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine?
2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine has a molecular weight of 257.36 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-butan-2-yl]-[1,3]thiazolo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 71551812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).