C83H91N7 — CID 71553206
3,5-bis[1-[4-[tris(4-tert-butylphenyl)methyl]phenyl]triazol-4-yl]pyridine (PubChem CID 71553206) has the molecular formula C83H91N7 and a molecular weight of 1186.69 g/mol. Its IUPAC name is 3,5-bis[1-[4-[tris(4-tert-butylphenyl)methyl]phenyl]triazol-4-yl]pyridine.
| Compound Name | 3,5-bis[1-[4-[tris(4-tert-butylphenyl)methyl]phenyl]triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 71553206 |
| Molecular Formula | C83H91N7 |
| Molecular Weight | 1186.69 g/mol |
| Exact Mass | 1185.73 |
| IUPAC Name | 3,5-bis[1-[4-[tris(4-tert-butylphenyl)methyl]phenyl]triazol-4-yl]pyridine |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(-n3cc(-c4cncc(-c5cn(-c6ccc(C(c7ccc(C(C)(C)C)cc7)(c7ccc(C(C)(C)C)cc7)c7ccc(C(C)(C)C)cc7)cc6)nn5)c4)nn3)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C83H91N7/c1-76(2,3)58-19-31-64(32-20-58)82(65-33-21-59(22-34-65)77(4,5)6,66-35-23-60(24-36-66)78(7,8)9)70-43-47-72(48-44-70)89-54-74(85-87-89)56-51-57(53-84-52-56)75-55-90(88-86-75)73-49-45-71(46-50-73)83(67-37-25-61(26-38-67)79(10,11)12,68-39-27-62(28-40-68)80(13,14)15)69-41-29-63(30-42-69)81(16,17)18/h19-55H,1-18H3 |
| InChIKey | KAEUIGDWQOTLOP-UHFFFAOYSA-N |
| XLogP | 20.13 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.69 |
| LogP ≤ 5 | 20.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|