C47H87N3 — CID 71553325
1-[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidin-4-yl]-4-methylpiperazine (PubChem CID 71553325) has the molecular formula C47H87N3 and a molecular weight of 694.23 g/mol. Its IUPAC name is 1-[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidin-4-yl]-4-methylpiperazine.
| Compound Name | 1-[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidin-4-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 71553325 |
| Molecular Formula | C47H87N3 |
| Molecular Weight | 694.23 g/mol |
| Exact Mass | 693.69 |
| IUPAC Name | 1-[1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidin-4-yl]-4-methylpiperazine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C47H87N3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-46(49-40-38-47(39-41-49)50-44-42-48(3)43-45-50)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,46-47H,4-11,16-17,22-45H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | GYBSZZDSKWKACE-QYCRHRGJSA-N |
| XLogP | 13.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.23 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|