C50H97N5 — CID 71553581
(6Z,9Z,28Z,31Z)-N-[[1,4-bis[2-(dimethylamino)ethyl]piperazin-2-yl]methyl]heptatriaconta-6,9,28,31-tetraen-19-amine (PubChem CID 71553581) has the molecular formula C50H97N5 and a molecular weight of 768.36 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-N-[[1,4-bis[2-(dimethylamino)ethyl]piperazin-2-yl]methyl]heptatriaconta-6,9,28,31-tetraen-19-amine.
| Compound Name | (6Z,9Z,28Z,31Z)-N-[[1,4-bis[2-(dimethylamino)ethyl]piperazin-2-yl]methyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
|---|---|
| PubChem CID | 71553581 |
| Molecular Formula | C50H97N5 |
| Molecular Weight | 768.36 g/mol |
| Exact Mass | 767.77 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-N-[[1,4-bis[2-(dimethylamino)ethyl]piperazin-2-yl]methyl]heptatriaconta-6,9,28,31-tetraen-19-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NCC1CN(CCN(C)C)CCN1CCN(C)C |
| InChI | InChI=1S/C50H97N5/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-49(40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2)51-47-50-48-54(43-41-52(3)4)44-46-55(50)45-42-53(5)6/h15-18,21-24,49-51H,7-14,19-20,25-48H2,1-6H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | JNPUJUJKSXOAED-MLLZQYMOSA-N |
| XLogP | 12.46 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.36 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|