C42H77N — CID 71553667
1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidine (PubChem CID 71553667) has the molecular formula C42H77N and a molecular weight of 596.09 g/mol. Its IUPAC name is 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidine.
| Compound Name | 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidine |
|---|---|
| PubChem CID | 71553667 |
| Molecular Formula | C42H77N |
| Molecular Weight | 596.09 g/mol |
| Exact Mass | 595.61 |
| IUPAC Name | 1-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N1CCCCC1 |
| InChI | InChI=1S/C42H77N/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-38-42(43-40-36-33-37-41-43)39-35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,42H,3-10,15-16,21-41H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ITNABPZARODOIJ-MAZCIEHSSA-N |
| XLogP | 14.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.09 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|