C41H80N2O — CID 71553668
2-(dimethylamino)-N-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]acetamide (PubChem CID 71553668) has the molecular formula C41H80N2O and a molecular weight of 617.10 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]acetamide |
|---|---|
| PubChem CID | 71553668 |
| Molecular Formula | C41H80N2O |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.63 |
| IUPAC Name | 2-(dimethylamino)-N-[(9Z,28Z)-heptatriaconta-9,28-dien-19-yl]acetamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)NC(=O)CN(C)C |
| InChI | InChI=1S/C41H80N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(42-41(44)39-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,40H,5-18,23-39H2,1-4H3,(H,42,44)/b21-19-,22-20- |
| InChIKey | HEGNHZQEXIOGKQ-WRBBJXAJSA-N |
| XLogP | 12.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|