C24H30BF3N2O4 — CID 71553830
2-amino-6-borono-2-[3-[[3-[4-(trifluoromethyl)phenyl]phenyl]methylamino]cyclobutyl]hexanoic acid (PubChem CID 71553830) has the molecular formula C24H30BF3N2O4 and a molecular weight of 478.32 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-[[3-[4-(trifluoromethyl)phenyl]phenyl]methylamino]cyclobutyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-[[3-[4-(trifluoromethyl)phenyl]phenyl]methylamino]cyclobutyl]hexanoic acid |
|---|---|
| PubChem CID | 71553830 |
| Molecular Formula | C24H30BF3N2O4 |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-amino-6-borono-2-[3-[[3-[4-(trifluoromethyl)phenyl]phenyl]methylamino]cyclobutyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CC(NCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)C1 |
| InChI | InChI=1S/C24H30BF3N2O4/c26-24(27,28)19-8-6-17(7-9-19)18-5-3-4-16(12-18)15-30-21-13-20(14-21)23(29,22(31)32)10-1-2-11-25(33)34/h3-9,12,20-21,30,33-34H,1-2,10-11,13-15,29H2,(H,31,32) |
| InChIKey | OJVCDCZQXJCJQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|