C47H88N2 — CID 71554278
(6Z,9Z,28Z,31Z)-N-methyl-N-(4-piperidin-4-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-amine (PubChem CID 71554278) has the molecular formula C47H88N2 and a molecular weight of 681.23 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-N-methyl-N-(4-piperidin-4-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-amine.
| Compound Name | (6Z,9Z,28Z,31Z)-N-methyl-N-(4-piperidin-4-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-amine |
|---|---|
| PubChem CID | 71554278 |
| Molecular Formula | C47H88N2 |
| Molecular Weight | 681.23 g/mol |
| Exact Mass | 680.69 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-N-methyl-N-(4-piperidin-4-ylbutyl)heptatriaconta-6,9,28,31-tetraen-19-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N(C)CCCCC1CCNCC1 |
| InChI | InChI=1S/C47H88N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39-47(49(3)45-37-36-38-46-41-43-48-44-42-46)40-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,46-48H,4-11,16-17,22-45H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | BYMIOQXTBOIHLR-QYCRHRGJSA-N |
| XLogP | 14.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.23 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|