About 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole
7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole (PubChem CID 71554723) has the molecular formula C23H25NO3
and a molecular weight of 363.46 g/mol. Its IUPAC name is 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole.
Molecular Properties
| Compound Name | 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole |
| PubChem CID | 71554723 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole |
| SMILES | COc1cc(C(=C2CCC2)c2cccc3ccn(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO3/c1-24-12-11-16-9-6-10-18(22(16)24)21(15-7-5-8-15)17-13-19(25-2)23(27-4)20(14-17)26-3/h6,9-14H,5,7-8H2,1-4H3 |
| InChIKey | ALALVTXKBXYJSF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole?
The IUPAC name of 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole (CID 71554723) is 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole.
What is the SMILES notation for 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole?
The canonical SMILES for 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole is COc1cc(C(=C2CCC2)c2cccc3ccn(C)c23)cc(OC)c1OC.
What is the InChIKey of 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole?
The InChIKey is ALALVTXKBXYJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO3/c1-24-12-11-16-9-6-10-18(22(16)24)21(15-7-5-8-15)17-13-19(25-2)23(27-4)20(14-17)26-3/h6,9-14H,5,7-8H2,1-4H3.
What are the key properties of 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole?
7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole has a molecular weight of 363.46 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-1-methylindole is sourced from PubChem (CID 71554723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).