About (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol
(S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol (PubChem CID 71555363) has the molecular formula C16H13Cl2F2NO
and a molecular weight of 344.19 g/mol. Its IUPAC name is (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol |
| PubChem CID | 71555363 |
| Molecular Formula | C16H13Cl2F2NO |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol |
| SMILES | O[C@H](c1ccccn1)C1(c2ccc(Cl)c(Cl)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C16H13Cl2F2NO/c17-11-5-4-10(7-12(11)18)15(8-16(19,20)9-15)14(22)13-3-1-2-6-21-13/h1-7,14,22H,8-9H2/t14-/m1/s1 |
| InChIKey | JBQJNSUVCCDNCP-CQSZACIVSA-N |
| XLogP | 4.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol?
The IUPAC name of (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol (CID 71555363) is (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol.
What is the SMILES notation for (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol?
The canonical SMILES for (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol is O[C@H](c1ccccn1)C1(c2ccc(Cl)c(Cl)c2)CC(F)(F)C1.
What is the InChIKey of (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol?
The InChIKey is JBQJNSUVCCDNCP-CQSZACIVSA-N. The full InChI is InChI=1S/C16H13Cl2F2NO/c17-11-5-4-10(7-12(11)18)15(8-16(19,20)9-15)14(22)13-3-1-2-6-21-13/h1-7,14,22H,8-9H2/t14-/m1/s1.
What are the key properties of (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol?
(S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol has a molecular weight of 344.19 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-[1-(3,4-dichlorophenyl)-3,3-difluorocyclobutyl]-pyridin-2-ylmethanol is sourced from PubChem (CID 71555363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).