C27H26Cl2N6O2 — CID 71555419
6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(oxetan-3-yl)pyrido[2,3-d]pyrimidin-5-one (PubChem CID 71555419) has the molecular formula C27H26Cl2N6O2 and a molecular weight of 537.45 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(oxetan-3-yl)pyrido[2,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(oxetan-3-yl)pyrido[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 71555419 |
| Molecular Formula | C27H26Cl2N6O2 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-(oxetan-3-yl)pyrido[2,3-d]pyrimidin-5-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)c(-c5c(Cl)cccc5Cl)cn(C5COC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H26Cl2N6O2/c1-33-9-11-34(12-10-33)18-7-5-17(6-8-18)31-27-30-13-20-25(36)21(24-22(28)3-2-4-23(24)29)14-35(26(20)32-27)19-15-37-16-19/h2-8,13-14,19H,9-12,15-16H2,1H3,(H,30,31,32) |
| InChIKey | SMXRRJDAWALKLK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|