C17H16F3NO2 — CID 71555594
3-[(S)-hydroxy(pyridin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-ol (PubChem CID 71555594) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 3-[(S)-hydroxy(pyridin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-ol.
| Compound Name | 3-[(S)-hydroxy(pyridin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 71555594 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-[(S)-hydroxy(pyridin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-ol |
| SMILES | OC1CC(c2ccc(C(F)(F)F)cc2)([C@H](O)c2ccccn2)C1 |
| InChI | InChI=1S/C17H16F3NO2/c18-17(19,20)12-6-4-11(5-7-12)16(9-13(22)10-16)15(23)14-3-1-2-8-21-14/h1-8,13,15,22-23H,9-10H2/t13?,15-,16?/m1/s1 |
| InChIKey | OEKIDEPMAPSIAR-OGVSOVDVSA-N |
| XLogP | 3.23 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |