About 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine
2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine (PubChem CID 71555609) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine |
| PubChem CID | 71555609 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine |
| SMILES | COc1ccc2c(N)c(C(=C3CCC3)c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C23H25NO5/c1-25-15-8-9-16-17(12-15)29-23(21(16)24)20(13-6-5-7-13)14-10-18(26-2)22(28-4)19(11-14)27-3/h8-12H,5-7,24H2,1-4H3 |
| InChIKey | QXEXPHXRPDPIOE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine?
The IUPAC name of 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine (CID 71555609) is 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine.
What is the SMILES notation for 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine?
The canonical SMILES for 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine is COc1ccc2c(N)c(C(=C3CCC3)c3cc(OC)c(OC)c(OC)c3)oc2c1.
What is the InChIKey of 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine?
The InChIKey is QXEXPHXRPDPIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO5/c1-25-15-8-9-16-17(12-15)29-23(21(16)24)20(13-6-5-7-13)14-10-18(26-2)22(28-4)19(11-14)27-3/h8-12H,5-7,24H2,1-4H3.
What are the key properties of 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine?
2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine has a molecular weight of 395.46 g/mol, XLogP of 5.04, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclobutylidene-(3,4,5-trimethoxyphenyl)methyl]-6-methoxy-1-benzofuran-3-amine is sourced from PubChem (CID 71555609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).