C19H16ClN3O4 — CID 71555905
(2R,3S)-3-[6-[4-[(6-chloro-3-pyridinyl)oxy]phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide (PubChem CID 71555905) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is (2R,3S)-3-[6-[4-[(6-chloro-3-pyridinyl)oxy]phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide.
| Compound Name | (2R,3S)-3-[6-[4-[(6-chloro-3-pyridinyl)oxy]phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 71555905 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (2R,3S)-3-[6-[4-[(6-chloro-3-pyridinyl)oxy]phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)c1cccc(-c2ccc(Oc3ccc(Cl)nc3)cc2)n1 |
| InChI | InChI=1S/C19H16ClN3O4/c20-16-9-8-13(10-22-16)27-12-6-4-11(5-7-12)14-2-1-3-15(23-14)17(24)18(25)19(21)26/h1-10,17-18,24-25H,(H2,21,26)/t17-,18+/m0/s1 |
| InChIKey | XAJNPHSIMCBHKT-ZWKOTPCHSA-N |
| XLogP | 2.47 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|