C19H11F3O5S — CID 71555971
2,6-di(18F)fluoro-4-[3-(3-(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl](18F3)phenol (PubChem CID 71555971) has the molecular formula C19H11F3O5S and a molecular weight of 405.36 g/mol. Its IUPAC name is 2,6-di(18F)fluoro-4-[3-(3-(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl](18F3)phenol.
| Compound Name | 2,6-di(18F)fluoro-4-[3-(3-(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl](18F3)phenol |
|---|---|
| PubChem CID | 71555971 |
| Molecular Formula | C19H11F3O5S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 2,6-di(18F)fluoro-4-[3-(3-(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl](18F3)phenol |
| SMILES | O=S1(=O)OC(c2ccc(O)c([18F])c2)(c2cc([18F])c(O)c([18F])c2)c2ccccc21 |
| InChI | InChI=1S/C19H11F3O5S/c20-13-7-10(5-6-16(13)23)19(11-8-14(21)18(24)15(22)9-11)12-3-1-2-4-17(12)28(25,26)27-19/h1-9,23-24H/i20-1,21-1,22-1 |
| InChIKey | RDFMEWBSJMCOIO-RBMXEHCHSA-N |
| XLogP | 3.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_sulfite_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|