C19H10F4O5S — CID 71555972
4-[3-(3,5-di(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]-2,6-di(18F)fluoro(18F4)phenol (PubChem CID 71555972) has the molecular formula C19H10F4O5S and a molecular weight of 422.35 g/mol. Its IUPAC name is 4-[3-(3,5-di(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]-2,6-di(18F)fluoro(18F4)phenol.
| Compound Name | 4-[3-(3,5-di(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]-2,6-di(18F)fluoro(18F4)phenol |
|---|---|
| PubChem CID | 71555972 |
| Molecular Formula | C19H10F4O5S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4-[3-(3,5-di(18F)fluoro-4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]-2,6-di(18F)fluoro(18F4)phenol |
| SMILES | O=S1(=O)OC(c2cc([18F])c(O)c([18F])c2)(c2cc([18F])c(O)c([18F])c2)c2ccccc21 |
| InChI | InChI=1S/C19H10F4O5S/c20-12-5-9(6-13(21)17(12)24)19(10-7-14(22)18(25)15(23)8-10)11-3-1-2-4-16(11)29(26,27)28-19/h1-8,24-25H/i20-1,21-1,22-1,23-1 |
| InChIKey | XLMVSHSPAXQMMZ-PJVUUPPDSA-N |
| XLogP | 3.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_sulfite_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|