C19H14O6 — CID 71556786
(7,12-dioxo-2,3-dihydronaphtho[2,3-h][1,4]benzodioxin-2-yl)methyl acetate (PubChem CID 71556786) has the molecular formula C19H14O6 and a molecular weight of 338.31 g/mol. Its IUPAC name is (7,12-dioxo-2,3-dihydronaphtho[2,3-h][1,4]benzodioxin-2-yl)methyl acetate.
| Compound Name | (7,12-dioxo-2,3-dihydronaphtho[2,3-h][1,4]benzodioxin-2-yl)methyl acetate |
|---|---|
| PubChem CID | 71556786 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (7,12-dioxo-2,3-dihydronaphtho[2,3-h][1,4]benzodioxin-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1COc2ccc3c(c2O1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H14O6/c1-10(20)23-8-11-9-24-15-7-6-14-16(19(15)25-11)18(22)13-5-3-2-4-12(13)17(14)21/h2-7,11H,8-9H2,1H3 |
| InChIKey | DKAKNZSEEPNTDF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|