About (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide
(2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide (PubChem CID 71556864) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide |
| PubChem CID | 71556864 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide |
| SMILES | N#Cc1ccc(Oc2ccc(-c3cccc([C@@H](O)[C@H](O)C(N)=O)n3)cc2)cc1 |
| InChI | InChI=1S/C21H17N3O4/c22-12-13-4-8-15(9-5-13)28-16-10-6-14(7-11-16)17-2-1-3-18(24-17)19(25)20(26)21(23)27/h1-11,19-20,25-26H,(H2,23,27)/t19-,20+/m1/s1 |
| InChIKey | PZSJUVFXYLWILL-UXHICEINSA-N |
| XLogP | 2.29 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide?
The IUPAC name of (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide (CID 71556864) is (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide.
What is the SMILES notation for (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide?
The canonical SMILES for (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide is N#Cc1ccc(Oc2ccc(-c3cccc([C@@H](O)[C@H](O)C(N)=O)n3)cc2)cc1.
What is the InChIKey of (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide?
The InChIKey is PZSJUVFXYLWILL-UXHICEINSA-N. The full InChI is InChI=1S/C21H17N3O4/c22-12-13-4-8-15(9-5-13)28-16-10-6-14(7-11-16)17-2-1-3-18(24-17)19(25)20(26)21(23)27/h1-11,19-20,25-26H,(H2,23,27)/t19-,20+/m1/s1.
What are the key properties of (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide?
(2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide has a molecular weight of 375.38 g/mol, XLogP of 2.29, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-[6-[4-(4-cyanophenoxy)phenyl]-2-pyridinyl]-2,3-dihydroxypropanamide is sourced from PubChem (CID 71556864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).