C35H37FN10O3 — CID 71557304
2-[5-fluoro-2-(hydroxymethyl)-3-[6-[[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one (PubChem CID 71557304) has the molecular formula C35H37FN10O3 and a molecular weight of 664.75 g/mol. Its IUPAC name is 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one.
| Compound Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 71557304 |
| Molecular Formula | C35H37FN10O3 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 2-[5-fluoro-2-(hydroxymethyl)-3-[6-[[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]amino]-7H-purin-2-yl]phenyl]-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-1-one |
| SMILES | O=C1c2cc3c(n2CCN1c1cc(F)cc(-c2nc(Nc4ccc(N5CCN(C6COC6)CC5)cn4)c4[nH]cnc4n2)c1CO)CCCC3 |
| InChI | InChI=1S/C35H37FN10O3/c36-22-14-25(26(17-47)28(15-22)46-12-11-45-27-4-2-1-3-21(27)13-29(45)35(46)48)32-41-33-31(38-20-39-33)34(42-32)40-30-6-5-23(16-37-30)43-7-9-44(10-8-43)24-18-49-19-24/h5-6,13-16,20,24,47H,1-4,7-12,17-19H2,(H2,37,38,39,40,41,42) |
| InChIKey | ONKSDIFEZGOZSZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |