C20H21F3N4O2 — CID 71557334
3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,2-benzoxazol-7-amine (PubChem CID 71557334) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,2-benzoxazol-7-amine.
| Compound Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,2-benzoxazol-7-amine |
|---|---|
| PubChem CID | 71557334 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,2-benzoxazol-7-amine |
| SMILES | COc1cc(-c2noc3c2CCCC3NCC(F)(F)F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C20H21F3N4O2/c1-12-9-27(11-25-12)16-7-6-13(8-17(16)28-2)18-14-4-3-5-15(19(14)29-26-18)24-10-20(21,22)23/h6-9,11,15,24H,3-5,10H2,1-2H3 |
| InChIKey | NWEFVYYZGXWFDP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |