C26H22BrN2O2+ — CID 71557854
1-(4-bromophenyl)-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone (PubChem CID 71557854) has the molecular formula C26H22BrN2O2+ and a molecular weight of 474.38 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 71557854 |
| Molecular Formula | C26H22BrN2O2+ |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-(4-bromophenyl)-2-[3-(3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-7-yl)benzimidazol-1-ium-1-yl]ethanone |
| SMILES | O=C(C[n+]1cn(C2CCc3cc4c(cc32)OCC4)c2ccccc21)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H22BrN2O2/c27-20-8-5-17(6-9-20)25(30)15-28-16-29(24-4-2-1-3-23(24)28)22-10-7-18-13-19-11-12-31-26(19)14-21(18)22/h1-6,8-9,13-14,16,22H,7,10-12,15H2/q+1 |
| InChIKey | AKAVVZYVFGJDDA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|