C15H18F3N5O2 — CID 71559020
2,2-dimethyl-N-pyrimidin-4-yl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide (PubChem CID 71559020) has the molecular formula C15H18F3N5O2 and a molecular weight of 357.34 g/mol. Its IUPAC name is 2,2-dimethyl-N-pyrimidin-4-yl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide.
| Compound Name | 2,2-dimethyl-N-pyrimidin-4-yl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide |
|---|---|
| PubChem CID | 71559020 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2,2-dimethyl-N-pyrimidin-4-yl-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]hexanamide |
| SMILES | CC(C)(CCCCc1noc(C(F)(F)F)n1)C(=O)Nc1ccncn1 |
| InChI | InChI=1S/C15H18F3N5O2/c1-14(2,12(24)21-10-6-8-19-9-20-10)7-4-3-5-11-22-13(25-23-11)15(16,17)18/h6,8-9H,3-5,7H2,1-2H3,(H,19,20,21,24) |
| InChIKey | CWRWABQIWVDFLO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|