C21H20ClF2N3O4S2 — CID 71559327
4-[[(1R,2R,5S)-2-(4-chlorophenyl)-5-hydroxycyclohexyl]methoxy]-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 71559327) has the molecular formula C21H20ClF2N3O4S2 and a molecular weight of 515.99 g/mol. Its IUPAC name is 4-[[(1R,2R,5S)-2-(4-chlorophenyl)-5-hydroxycyclohexyl]methoxy]-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-[[(1R,2R,5S)-2-(4-chlorophenyl)-5-hydroxycyclohexyl]methoxy]-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71559327 |
| Molecular Formula | C21H20ClF2N3O4S2 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 4-[[(1R,2R,5S)-2-(4-chlorophenyl)-5-hydroxycyclohexyl]methoxy]-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(F)c(OC[C@@H]2C[C@@H](O)CC[C@H]2c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C21H20ClF2N3O4S2/c22-14-3-1-12(2-4-14)16-6-5-15(28)7-13(16)10-31-19-8-18(24)20(9-17(19)23)33(29,30)27-21-25-11-26-32-21/h1-4,8-9,11,13,15-16,28H,5-7,10H2,(H,25,26,27)/t13-,15-,16-/m0/s1 |
| InChIKey | XKUSDXSGJPVRMR-BPUTZDHNSA-N |
| XLogP | 4.59 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |