C30H38ClN3O2S — CID 71559448
ethyl (1S,4S,5R,9S,10S,13S)-16-[(4-chlorophenyl)carbamothioyl]-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate (PubChem CID 71559448) has the molecular formula C30H38ClN3O2S and a molecular weight of 540.17 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S)-16-[(4-chlorophenyl)carbamothioyl]-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S)-16-[(4-chlorophenyl)carbamothioyl]-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate |
|---|---|
| PubChem CID | 71559448 |
| Molecular Formula | C30H38ClN3O2S |
| Molecular Weight | 540.17 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S)-16-[(4-chlorophenyl)carbamothioyl]-5,9,13-trimethyl-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)c1cn(C(=S)Nc2ccc(Cl)cc2)nc14 |
| InChI | InChI=1S/C30H38ClN3O2S/c1-5-36-25(35)29(4)14-6-13-28(3)22(29)12-16-30-18-27(2,15-11-23(28)30)24-21(30)17-34(33-24)26(37)32-20-9-7-19(31)8-10-20/h7-10,17,22-23H,5-6,11-16,18H2,1-4H3,(H,32,37)/t22-,23-,27-,28+,29+,30+/m0/s1 |
| InChIKey | ISDFAASFPICPDA-AWXAYHHUSA-N |
| XLogP | 7.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.17 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|