C21H27NO — CID 71559524
1-adamantyl-(3,3-dimethyl-2H-indol-1-yl)methanone (PubChem CID 71559524) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-adamantyl-(3,3-dimethyl-2H-indol-1-yl)methanone.
| Compound Name | 1-adamantyl-(3,3-dimethyl-2H-indol-1-yl)methanone |
|---|---|
| PubChem CID | 71559524 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-adamantyl-(3,3-dimethyl-2H-indol-1-yl)methanone |
| SMILES | CC1(C)CN(C(=O)C23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C21H27NO/c1-20(2)13-22(18-6-4-3-5-17(18)20)19(23)21-10-14-7-15(11-21)9-16(8-14)12-21/h3-6,14-16H,7-13H2,1-2H3 |
| InChIKey | ZLQWPOMATSXNAY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |