C31H41N3O2S — CID 71559557
ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-16-[(2-methylphenyl)carbamothioyl]-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate (PubChem CID 71559557) has the molecular formula C31H41N3O2S and a molecular weight of 519.76 g/mol. Its IUPAC name is ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-16-[(2-methylphenyl)carbamothioyl]-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate.
| Compound Name | ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-16-[(2-methylphenyl)carbamothioyl]-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate |
|---|---|
| PubChem CID | 71559557 |
| Molecular Formula | C31H41N3O2S |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | ethyl (1S,4S,5R,9S,10S,13S)-5,9,13-trimethyl-16-[(2-methylphenyl)carbamothioyl]-15,16-diazapentacyclo[11.5.1.01,10.04,9.014,18]nonadeca-14,17-diene-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CC[C@@]4(C)C[C@]3(CC[C@@H]21)c1cn(C(=S)Nc2ccccc2C)nc14 |
| InChI | InChI=1S/C31H41N3O2S/c1-6-36-26(35)30(5)15-9-14-29(4)23(30)13-17-31-19-28(3,16-12-24(29)31)25-21(31)18-34(33-25)27(37)32-22-11-8-7-10-20(22)2/h7-8,10-11,18,23-24H,6,9,12-17,19H2,1-5H3,(H,32,37)/t23-,24-,28-,29+,30+,31+/m0/s1 |
| InChIKey | CNTCHUKVFOLXQU-KNAGWPEFSA-N |
| XLogP | 6.92 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|