About 2-adamantyl(2,3-dihydroindol-1-yl)methanone
2-adamantyl(2,3-dihydroindol-1-yl)methanone (PubChem CID 71559641) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-adamantyl(2,3-dihydroindol-1-yl)methanone.
Molecular Properties
| Compound Name | 2-adamantyl(2,3-dihydroindol-1-yl)methanone |
| PubChem CID | 71559641 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-adamantyl(2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(C1C2CC3CC(C2)CC1C3)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H23NO/c21-19(20-6-5-14-3-1-2-4-17(14)20)18-15-8-12-7-13(10-15)11-16(18)9-12/h1-4,12-13,15-16,18H,5-11H2 |
| InChIKey | RTHRVYFSGYJUOV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-adamantyl(2,3-dihydroindol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl(2,3-dihydroindol-1-yl)methanone?
The IUPAC name of 2-adamantyl(2,3-dihydroindol-1-yl)methanone (CID 71559641) is 2-adamantyl(2,3-dihydroindol-1-yl)methanone.
What is the SMILES notation for 2-adamantyl(2,3-dihydroindol-1-yl)methanone?
The canonical SMILES for 2-adamantyl(2,3-dihydroindol-1-yl)methanone is O=C(C1C2CC3CC(C2)CC1C3)N1CCc2ccccc21.
What is the InChIKey of 2-adamantyl(2,3-dihydroindol-1-yl)methanone?
The InChIKey is RTHRVYFSGYJUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO/c21-19(20-6-5-14-3-1-2-4-17(14)20)18-15-8-12-7-13(10-15)11-16(18)9-12/h1-4,12-13,15-16,18H,5-11H2.
What are the key properties of 2-adamantyl(2,3-dihydroindol-1-yl)methanone?
2-adamantyl(2,3-dihydroindol-1-yl)methanone has a molecular weight of 281.40 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl(2,3-dihydroindol-1-yl)methanone is sourced from PubChem (CID 71559641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).