C19H29N2O4+ — CID 71559813
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1R)-1,2,3,4-tetrahydroquinolizin-5-ium-1-yl]carbamate (PubChem CID 71559813) has the molecular formula C19H29N2O4+ and a molecular weight of 349.45 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1R)-1,2,3,4-tetrahydroquinolizin-5-ium-1-yl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1R)-1,2,3,4-tetrahydroquinolizin-5-ium-1-yl]carbamate |
|---|---|
| PubChem CID | 71559813 |
| Molecular Formula | C19H29N2O4+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(1R)-1,2,3,4-tetrahydroquinolizin-5-ium-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@H]1CCC[n+]2ccccc21 |
| InChI | InChI=1S/C19H29N2O4/c1-18(2,3)24-16(22)21(17(23)25-19(4,5)6)15-11-9-13-20-12-8-7-10-14(15)20/h7-8,10,12,15H,9,11,13H2,1-6H3/q+1/t15-/m1/s1 |
| InChIKey | UHCRSMDABPCULU-OAHLLOKOSA-N |
| XLogP | 3.98 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|