C26H34N6O3 — CID 71560030
2-[[3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl]phenyl]methylamino]ethanol (PubChem CID 71560030) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-[[3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 71560030 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 2-[[3-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-morpholin-4-ylpyrido[2,3-d]pyrimidin-7-yl]phenyl]methylamino]ethanol |
| SMILES | C[C@@H]1CN(c2nc(N3CCOCC3)c3ccc(-c4cccc(CNCCO)c4)nc3n2)C[C@H](C)O1 |
| InChI | InChI=1S/C26H34N6O3/c1-18-16-32(17-19(2)35-18)26-29-24-22(25(30-26)31-9-12-34-13-10-31)6-7-23(28-24)21-5-3-4-20(14-21)15-27-8-11-33/h3-7,14,18-19,27,33H,8-13,15-17H2,1-2H3/t18-,19+ |
| InChIKey | IFKPFSWLXNIXBW-KDURUIRLSA-N |
| XLogP | 2.22 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|