C19H19FN6O2 — CID 71560157
2-[1-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-4-yl]acetonitrile (PubChem CID 71560157) has the molecular formula C19H19FN6O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[1-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-4-yl]acetonitrile.
| Compound Name | 2-[1-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 71560157 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[1-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,6-dihydro-2H-pyridin-4-yl]acetonitrile |
| SMILES | N#CCC1=CCN(c2ccc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H19FN6O2/c20-17-11-15(1-2-18(17)24-8-4-14(3-6-21)5-9-24)26-13-16(28-19(26)27)12-25-10-7-22-23-25/h1-2,4,7,10-11,16H,3,5,8-9,12-13H2/t16-/m0/s1 |
| InChIKey | ATLNIYICEDCRBJ-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|