About (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one
(2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one (PubChem CID 71560885) has the molecular formula C16H18BrNO3
and a molecular weight of 352.23 g/mol. Its IUPAC name is (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one |
| PubChem CID | 71560885 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@@H](C[N+](=O)[O-])/C(Br)=C/c1ccccc1 |
| InChI | InChI=1S/C16H18BrNO3/c17-15(10-12-6-2-1-3-7-12)14(11-18(20)21)13-8-4-5-9-16(13)19/h1-3,6-7,10,13-14H,4-5,8-9,11H2/b15-10-/t13-,14+/m0/s1 |
| InChIKey | JUINKGMHVQYJRH-NMIINTFJSA-N |
| XLogP | 4.07 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The IUPAC name of (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one (CID 71560885) is (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one.
What is the SMILES notation for (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The canonical SMILES for (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one is O=C1CCCC[C@H]1[C@@H](C[N+](=O)[O-])/C(Br)=C/c1ccccc1.
What is the InChIKey of (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The InChIKey is JUINKGMHVQYJRH-NMIINTFJSA-N. The full InChI is InChI=1S/C16H18BrNO3/c17-15(10-12-6-2-1-3-7-12)14(11-18(20)21)13-8-4-5-9-16(13)19/h1-3,6-7,10,13-14H,4-5,8-9,11H2/b15-10-/t13-,14+/m0/s1.
What are the key properties of (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
(2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one has a molecular weight of 352.23 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(Z,2S)-3-bromo-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one is sourced from PubChem (CID 71560885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).