About CID 71561190
CID 71561190 (PubChem CID 71561190) has the molecular formula C30H23NO2
and a molecular weight of 429.52 g/mol.
Molecular Properties
| Compound Name | CID 71561190 |
| PubChem CID | 71561190 |
| Molecular Formula | C30H23NO2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccccc2)[C@]2(Cc3ccccc3C2=O)[C@]12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C30H23NO2/c1-31-18-25(19-9-3-2-4-10-19)29(17-21-11-5-6-14-22(21)27(29)32)30(31)24-16-8-13-20-12-7-15-23(26(20)24)28(30)33/h2-16,25H,17-18H2,1H3/t25-,29+,30+/m1/s1 |
| InChIKey | QNGSRZAVORFRJE-CPESWEKQSA-N |
| XLogP | 5.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 71561190 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71561190?
The IUPAC name of CID 71561190 (CID 71561190) is not available.
What is the SMILES notation for CID 71561190?
The canonical SMILES for CID 71561190 is CN1C[C@H](c2ccccc2)[C@]2(Cc3ccccc3C2=O)[C@]12C(=O)c1cccc3cccc2c13.
What is the InChIKey of CID 71561190?
The InChIKey is QNGSRZAVORFRJE-CPESWEKQSA-N. The full InChI is InChI=1S/C30H23NO2/c1-31-18-25(19-9-3-2-4-10-19)29(17-21-11-5-6-14-22(21)27(29)32)30(31)24-16-8-13-20-12-7-15-23(26(20)24)28(30)33/h2-16,25H,17-18H2,1H3/t25-,29+,30+/m1/s1.
What are the key properties of CID 71561190?
CID 71561190 has a molecular weight of 429.52 g/mol, XLogP of 5.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71561190 is sourced from PubChem (CID 71561190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).