About (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole
(5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 71561453) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 71561453 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(C[C@H]2CC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C16H15NO/c1-3-7-13(8-4-1)11-15-12-16(17-18-15)14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m0/s1 |
| InChIKey | IMTGFFLRCGPYTN-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole (CID 71561453) is (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole is c1ccc(C[C@H]2CC(c3ccccc3)=NO2)cc1.
What is the InChIKey of (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole?
The InChIKey is IMTGFFLRCGPYTN-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H15NO/c1-3-7-13(8-4-1)11-15-12-16(17-18-15)14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m0/s1.
What are the key properties of (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole?
(5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole has a molecular weight of 237.30 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-benzyl-3-phenyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 71561453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).